C66H46N6OSi — CID 169052782
CID 169052782 (PubChem CID 169052782) has the molecular formula C66H46N6OSi and a molecular weight of 977.28 g/mol.
| Compound Name | CID 169052782 |
|---|---|
| PubChem CID | 169052782 |
| Molecular Formula | C66H46N6OSi |
| Molecular Weight | 977.28 g/mol |
| Exact Mass | 976.41 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-[n+]2[c-]n3c4c(cccc42)[Si](c2ccc(C#N)cc2)(c2ccc(C#N)cc2)c2ccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)cc2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C66H46N6OSi/c1-66(2,3)48-36-37-69-63(38-48)72-57-21-11-10-18-55(57)56-34-28-49(39-59(56)72)73-50-29-35-61-60(40-50)71-43-70(64-53(46-14-6-4-7-15-46)19-12-20-54(64)47-16-8-5-9-17-47)58-22-13-23-62(65(58)71)74(61,51-30-24-44(41-67)25-31-51)52-32-26-45(42-68)27-33-52/h4-40H,1-3H3/i4D,5D,6D,7D,8D,9D,14D,15D,16D,17D |
| InChIKey | HVRSZCZPNGUKGL-SFKATSICSA-N |
| XLogP | 12.06 |
| TPSA | 83.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.28 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|