C22H25F3N4O — CID 164736110
1-[(1R)-2,2,2-trifluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 164736110) has the molecular formula C22H25F3N4O and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 164736110 |
| Molecular Formula | C22H25F3N4O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | CN1CCN(c2ccc([C@H](C3NCc4cc(C(N)=O)ccc43)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H25F3N4O/c1-28-8-10-29(11-9-28)17-5-2-14(3-6-17)19(22(23,24)25)20-18-7-4-15(21(26)30)12-16(18)13-27-20/h2-7,12,19-20,27H,8-11,13H2,1H3,(H2,26,30)/t19-,20?/m1/s1 |
| InChIKey | VMVVJNGUGKXORC-FIWHBWSRSA-N |
| XLogP | 3.03 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|