C21H22F3N3O2 — CID 164736147
1-[(1R)-2,2,2-trifluoro-1-(4-morpholin-4-ylphenyl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 164736147) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(4-morpholin-4-ylphenyl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(4-morpholin-4-ylphenyl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 164736147 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(4-morpholin-4-ylphenyl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)CNC2[C@@H](c1ccc(N2CCOCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H22F3N3O2/c22-21(23,24)18(13-1-4-16(5-2-13)27-7-9-29-10-8-27)19-17-6-3-14(20(25)28)11-15(17)12-26-19/h1-6,11,18-19,26H,7-10,12H2,(H2,25,28)/t18-,19?/m1/s1 |
| InChIKey | SNZOTCUYZATLSC-MRTLOADZSA-N |
| XLogP | 3.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|