C15H19IN4O2 — CID 164736270
tert-butyl 3-[(3-iodopyrazolo[4,3-c]pyridin-1-yl)methyl]azetidine-1-carboxylate (PubChem CID 164736270) has the molecular formula C15H19IN4O2 and a molecular weight of 414.25 g/mol. Its IUPAC name is tert-butyl 3-[(3-iodopyrazolo[4,3-c]pyridin-1-yl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-iodopyrazolo[4,3-c]pyridin-1-yl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164736270 |
| Molecular Formula | C15H19IN4O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | tert-butyl 3-[(3-iodopyrazolo[4,3-c]pyridin-1-yl)methyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cn2nc(I)c3cnccc32)C1 |
| InChI | InChI=1S/C15H19IN4O2/c1-15(2,3)22-14(21)19-7-10(8-19)9-20-12-4-5-17-6-11(12)13(16)18-20/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | PGBGQVMHMBHOCH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|