C40H29N5OPt — CID 164736637
1-(2,6-dimethylphenyl)benzimidazole;4-(phenoxy)-6-phenylbenzimidazolo[1,2-a]benzimidazole;platinum(2+) (PubChem CID 164736637) has the molecular formula C40H29N5OPt and a molecular weight of 790.78 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)benzimidazole;4-(phenoxy)-6-phenylbenzimidazolo[1,2-a]benzimidazole;platinum(2+).
| Compound Name | 1-(2,6-dimethylphenyl)benzimidazole;4-(phenoxy)-6-phenylbenzimidazolo[1,2-a]benzimidazole;platinum(2+) |
|---|---|
| PubChem CID | 164736637 |
| Molecular Formula | C40H29N5OPt |
| Molecular Weight | 790.78 g/mol |
| Exact Mass | 790.20 |
| IUPAC Name | 1-(2,6-dimethylphenyl)benzimidazole;4-(phenoxy)-6-phenylbenzimidazolo[1,2-a]benzimidazole;platinum(2+) |
| SMILES | Cc1cccc(C)c1-n1cnc2ccccc21.[Pt+2].[c-]1ccccc1Oc1cccc2c1nc1n(-c3[c-]cccc3)c3ccccc3n21 |
| InChI | InChI=1S/C25H15N3O.C15H14N2.Pt/c1-3-10-18(11-4-1)27-20-14-7-8-15-21(20)28-22-16-9-17-23(24(22)26-25(27)28)29-19-12-5-2-6-13-19;1-11-6-5-7-12(2)15(11)17-10-16-13-8-3-4-9-14(13)17;/h1-10,12,14-17H;3-10H,1-2H3;/q-2;;+2 |
| InChIKey | XDYGRUFLNPWMEP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.78 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|