C31H33N3Pt — CID 164739866
tert-butyl-[2-[C-tert-butyl-N-[(1-phenylisoquinolin-3-yl)methyl]carbonimidoyl]phenyl]azanide;platinum(2+) (PubChem CID 164739866) has the molecular formula C31H33N3Pt and a molecular weight of 642.70 g/mol. Its IUPAC name is tert-butyl-[2-[C-tert-butyl-N-[(1-phenylisoquinolin-3-yl)methyl]carbonimidoyl]phenyl]azanide;platinum(2+).
| Compound Name | tert-butyl-[2-[C-tert-butyl-N-[(1-phenylisoquinolin-3-yl)methyl]carbonimidoyl]phenyl]azanide;platinum(2+) |
|---|---|
| PubChem CID | 164739866 |
| Molecular Formula | C31H33N3Pt |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | tert-butyl-[2-[C-tert-butyl-N-[(1-phenylisoquinolin-3-yl)methyl]carbonimidoyl]phenyl]azanide;platinum(2+) |
| SMILES | CC(C)(C)[N-]c1ccccc1/C(=N/Cc1cc2ccccc2c(-c2[c-]cccc2)n1)C(C)(C)C.[Pt+2] |
| InChI | InChI=1S/C31H33N3.Pt/c1-30(2,3)29(26-18-12-13-19-27(26)34-31(4,5)6)32-21-24-20-23-16-10-11-17-25(23)28(33-24)22-14-8-7-9-15-22;/h7-14,16-20H,21H2,1-6H3;/q-2;+2/b32-29-; |
| InChIKey | KZLNJZMMOXFXEL-ILHCEFDCSA-N |
| XLogP | 8.54 |
| TPSA | 39.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|