C46H32N2Pt — CID 140824228
3-[10,10-dimethyl-9-(1-phenylisoquinolin-3-yl)anthracen-9-yl]-1-phenylisoquinoline;platinum(2+) (PubChem CID 140824228) has the molecular formula C46H32N2Pt and a molecular weight of 807.85 g/mol. Its IUPAC name is 3-[10,10-dimethyl-9-(1-phenylisoquinolin-3-yl)anthracen-9-yl]-1-phenylisoquinoline;platinum(2+).
| Compound Name | 3-[10,10-dimethyl-9-(1-phenylisoquinolin-3-yl)anthracen-9-yl]-1-phenylisoquinoline;platinum(2+) |
|---|---|
| PubChem CID | 140824228 |
| Molecular Formula | C46H32N2Pt |
| Molecular Weight | 807.85 g/mol |
| Exact Mass | 807.22 |
| IUPAC Name | 3-[10,10-dimethyl-9-(1-phenylisoquinolin-3-yl)anthracen-9-yl]-1-phenylisoquinoline;platinum(2+) |
| SMILES | CC1(C)c2ccccc2C(c2cc3ccccc3c(-c3[c-]cccc3)n2)(c2cc3ccccc3c(-c3[c-]cccc3)n2)c2ccccc21.[Pt+2] |
| InChI | InChI=1S/C46H32N2.Pt/c1-45(2)37-25-13-15-27-39(37)46(40-28-16-14-26-38(40)45,41-29-33-21-9-11-23-35(33)43(47-41)31-17-5-3-6-18-31)42-30-34-22-10-12-24-36(34)44(48-42)32-19-7-4-8-20-32;/h3-17,19,21-30H,1-2H3;/q-2;+2 |
| InChIKey | UYINHANDXTUFLU-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.85 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|