C47H30N2PtS — CID 140824206
2-[2,7-diphenyl-9-(6-phenyl-2-pyridinyl)thioxanthen-9-yl]-6-phenylpyridine;platinum(2+) (PubChem CID 140824206) has the molecular formula C47H30N2PtS and a molecular weight of 849.92 g/mol. Its IUPAC name is 2-[2,7-diphenyl-9-(6-phenyl-2-pyridinyl)thioxanthen-9-yl]-6-phenylpyridine;platinum(2+).
| Compound Name | 2-[2,7-diphenyl-9-(6-phenyl-2-pyridinyl)thioxanthen-9-yl]-6-phenylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 140824206 |
| Molecular Formula | C47H30N2PtS |
| Molecular Weight | 849.92 g/mol |
| Exact Mass | 849.18 |
| IUPAC Name | 2-[2,7-diphenyl-9-(6-phenyl-2-pyridinyl)thioxanthen-9-yl]-6-phenylpyridine;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(C2(c3cccc(-c4[c-]cccc4)n3)c3cc(-c4ccccc4)ccc3Sc3ccc(-c4ccccc4)cc32)n1 |
| InChI | InChI=1S/C47H30N2S.Pt/c1-5-15-33(16-6-1)37-27-29-43-39(31-37)47(45-25-13-23-41(48-45)35-19-9-3-10-20-35,46-26-14-24-42(49-46)36-21-11-4-12-22-36)40-32-38(28-30-44(40)50-43)34-17-7-2-8-18-34;/h1-19,21,23-32H;/q-2;+2 |
| InChIKey | PAQCRCAJQXPPRO-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.92 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|