C37H26N2OPt — CID 140824186
2-[2,7-dimethyl-9-(6-phenyl-2-pyridinyl)xanthen-9-yl]-6-phenylpyridine;platinum(2+) (PubChem CID 140824186) has the molecular formula C37H26N2OPt and a molecular weight of 709.71 g/mol. Its IUPAC name is 2-[2,7-dimethyl-9-(6-phenyl-2-pyridinyl)xanthen-9-yl]-6-phenylpyridine;platinum(2+).
| Compound Name | 2-[2,7-dimethyl-9-(6-phenyl-2-pyridinyl)xanthen-9-yl]-6-phenylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 140824186 |
| Molecular Formula | C37H26N2OPt |
| Molecular Weight | 709.71 g/mol |
| Exact Mass | 709.17 |
| IUPAC Name | 2-[2,7-dimethyl-9-(6-phenyl-2-pyridinyl)xanthen-9-yl]-6-phenylpyridine;platinum(2+) |
| SMILES | Cc1ccc2c(c1)C(c1cccc(-c3[c-]cccc3)n1)(c1cccc(-c3[c-]cccc3)n1)c1cc(C)ccc1O2.[Pt+2] |
| InChI | InChI=1S/C37H26N2O.Pt/c1-25-19-21-33-29(23-25)37(30-24-26(2)20-22-34(30)40-33,35-17-9-15-31(38-35)27-11-5-3-6-12-27)36-18-10-16-32(39-36)28-13-7-4-8-14-28;/h3-11,13,15-24H,1-2H3;/q-2;+2 |
| InChIKey | FLCCMCLVWNXSLS-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.71 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|