C31H24N2O — CID 101124309
2-[9-(1H-indol-2-yl)-2,7-dimethylxanthen-9-yl]-1H-indole (PubChem CID 101124309) has the molecular formula C31H24N2O and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[9-(1H-indol-2-yl)-2,7-dimethylxanthen-9-yl]-1H-indole.
| Compound Name | 2-[9-(1H-indol-2-yl)-2,7-dimethylxanthen-9-yl]-1H-indole |
|---|---|
| PubChem CID | 101124309 |
| Molecular Formula | C31H24N2O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[9-(1H-indol-2-yl)-2,7-dimethylxanthen-9-yl]-1H-indole |
| SMILES | Cc1ccc2c(c1)C(c1cc3ccccc3[nH]1)(c1cc3ccccc3[nH]1)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C31H24N2O/c1-19-11-13-27-23(15-19)31(24-16-20(2)12-14-28(24)34-27,29-17-21-7-3-5-9-25(21)32-29)30-18-22-8-4-6-10-26(22)33-30/h3-18,32-33H,1-2H3 |
| InChIKey | MVIADGCBYAUNPB-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |