C19H20O — CID 142509927
9-[(Z)-but-2-enyl]-2,9-dimethylxanthene (PubChem CID 142509927) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 9-[(Z)-but-2-enyl]-2,9-dimethylxanthene.
| Compound Name | 9-[(Z)-but-2-enyl]-2,9-dimethylxanthene |
|---|---|
| PubChem CID | 142509927 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 9-[(Z)-but-2-enyl]-2,9-dimethylxanthene |
| SMILES | C/C=C\CC1(C)c2ccccc2Oc2ccc(C)cc21 |
| InChI | InChI=1S/C19H20O/c1-4-5-12-19(3)15-8-6-7-9-17(15)20-18-11-10-14(2)13-16(18)19/h4-11,13H,12H2,1-3H3/b5-4- |
| InChIKey | MAGJTZIFPPPCNT-PLNGDYQASA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|