C64H49N5PtS — CID 165167985
8,9-ditert-butyl-6-[6-[9-[4-(2,6-diphenyl-4-pyridinyl)-6-phenyl-2-pyridinyl]fluoren-9-yl]-2-pyridinyl]-5H-thieno[3,2-f]quinoxalin-5-ide;platinum(2+) (PubChem CID 165167985) has the molecular formula C64H49N5PtS and a molecular weight of 1115.28 g/mol. Its IUPAC name is 8,9-ditert-butyl-6-[6-[9-[4-(2,6-diphenyl-4-pyridinyl)-6-phenyl-2-pyridinyl]fluoren-9-yl]-2-pyridinyl]-5H-thieno[3,2-f]quinoxalin-5-ide;platinum(2+).
| Compound Name | 8,9-ditert-butyl-6-[6-[9-[4-(2,6-diphenyl-4-pyridinyl)-6-phenyl-2-pyridinyl]fluoren-9-yl]-2-pyridinyl]-5H-thieno[3,2-f]quinoxalin-5-ide;platinum(2+) |
|---|---|
| PubChem CID | 165167985 |
| Molecular Formula | C64H49N5PtS |
| Molecular Weight | 1115.28 g/mol |
| Exact Mass | 1114.34 |
| IUPAC Name | 8,9-ditert-butyl-6-[6-[9-[4-(2,6-diphenyl-4-pyridinyl)-6-phenyl-2-pyridinyl]fluoren-9-yl]-2-pyridinyl]-5H-thieno[3,2-f]quinoxalin-5-ide;platinum(2+) |
| SMILES | CC(C)(C)c1sc2c(-c3cccc(C4(c5cc(-c6cc(-c7ccccc7)nc(-c7ccccc7)c6)cc(-c6[c-]cccc6)n5)c5ccccc5-c5ccccc54)n3)[c-]c3nccnc3c2c1C(C)(C)C.[Pt+2] |
| InChI | InChI=1S/C64H49N5S.Pt/c1-62(2,3)58-57-59-54(65-33-34-66-59)39-47(60(57)70-61(58)63(4,5)6)50-31-20-32-55(68-50)64(48-29-18-16-27-45(48)46-28-17-19-30-49(46)64)56-38-44(37-53(69-56)42-25-14-9-15-26-42)43-35-51(40-21-10-7-11-22-40)67-52(36-43)41-23-12-8-13-24-41;/h7-25,27-38H,1-6H3;/q-2;+2 |
| InChIKey | PIPNXTWQEUMMER-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.28 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|