C42H29IrN3O-2 — CID 170514343
iridium;2-(phenyliminomethyl)phenol;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine (PubChem CID 170514343) has the molecular formula C42H29IrN3O-2 and a molecular weight of 783.93 g/mol. Its IUPAC name is iridium;2-(phenyliminomethyl)phenol;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine.
| Compound Name | iridium;2-(phenyliminomethyl)phenol;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine |
|---|---|
| PubChem CID | 170514343 |
| Molecular Formula | C42H29IrN3O-2 |
| Molecular Weight | 783.93 g/mol |
| Exact Mass | 784.20 |
| IUPAC Name | iridium;2-(phenyliminomethyl)phenol;2-phenyl-6-[(9R)-9-pyridin-2-yl-1H-fluoren-1-id-9-yl]pyridine |
| SMILES | Oc1ccccc1/C=N/c1ccccc1.[Ir].[c-]1ccccc1-c1cccc([C@]2(c3ccccn3)c3[c-]cccc3-c3ccccc32)n1 |
| InChI | InChI=1S/C29H18N2.C13H11NO.Ir/c1-2-11-21(12-3-1)26-17-10-19-28(31-26)29(27-18-8-9-20-30-27)24-15-6-4-13-22(24)23-14-5-7-16-25(23)29;15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h1-11,13-15,17-20H;1-10,15H;/q-2;;/b;14-10+;/t29-;;/m0../s1 |
| InChIKey | WMGJOEZKHXWETC-HURCMZCDSA-N |
| XLogP | 9.25 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.93 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|