About N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine)
N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) (PubChem CID 140549187) has the molecular formula C33H24BrIrN4-3
and a molecular weight of 748.70 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine).
Molecular Properties
| Compound Name | N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) |
| PubChem CID | 140549187 |
| Molecular Formula | C33H24BrIrN4-3 |
| Molecular Weight | 748.70 g/mol |
| Exact Mass | 748.08 |
| IUPAC Name | N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) |
| SMILES | Brc1ccc(/N=C/c2ccc[n-]2)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8BrN2.2C11H8N.Ir/c12-9-3-5-10(6-4-9)14-8-11-2-1-7-13-11;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H;2*1-6,8-9H;/q3*-1;/b14-8+;;; |
| InChIKey | YGHMSSHGAZAHCW-ORHNGELRSA-N |
| XLogP | 8.25 |
| TPSA | 52.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 748.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine)?
The IUPAC name of N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) (CID 140549187) is N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine).
What is the SMILES notation for N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine)?
The canonical SMILES for N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) is Brc1ccc(/N=C/c2ccc[n-]2)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine)?
The InChIKey is YGHMSSHGAZAHCW-ORHNGELRSA-N. The full InChI is InChI=1S/C11H8BrN2.2C11H8N.Ir/c12-9-3-5-10(6-4-9)14-8-11-2-1-7-13-11;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-8H;2*1-6,8-9H;/q3*-1;/b14-8+;;;.
What are the key properties of N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine)?
N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) has a molecular weight of 748.70 g/mol, XLogP of 8.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-1-pyrrol-1-id-2-ylmethanimine;iridium;bis(2-phenylpyridine) is sourced from PubChem (CID 140549187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).