C35H29IrN4O-3 — CID 140549181
3,5-dimethyl-4-(pyrrol-1-id-2-ylmethylideneamino)phenol;iridium;bis(2-phenylpyridine) (PubChem CID 140549181) has the molecular formula C35H29IrN4O-3 and a molecular weight of 713.86 g/mol. Its IUPAC name is 3,5-dimethyl-4-(pyrrol-1-id-2-ylmethylideneamino)phenol;iridium;bis(2-phenylpyridine).
| Compound Name | 3,5-dimethyl-4-(pyrrol-1-id-2-ylmethylideneamino)phenol;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 140549181 |
| Molecular Formula | C35H29IrN4O-3 |
| Molecular Weight | 713.86 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | 3,5-dimethyl-4-(pyrrol-1-id-2-ylmethylideneamino)phenol;iridium;bis(2-phenylpyridine) |
| SMILES | Cc1cc(O)cc(C)c1/N=C/c1ccc[n-]1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C13H13N2O.2C11H8N.Ir/c1-9-6-12(16)7-10(2)13(9)15-8-11-4-3-5-14-11;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-8H,1-2H3,(H-,14,15,16);2*1-6,8-9H;/q3*-1; |
| InChIKey | GLNDIUDJDPXGJW-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.86 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|