C26H31IrN2O- — CID 135967420
2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-phenylpyridine (PubChem CID 135967420) has the molecular formula C26H31IrN2O- and a molecular weight of 579.76 g/mol. Its IUPAC name is 2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-phenylpyridine.
| Compound Name | 2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 135967420 |
| Molecular Formula | C26H31IrN2O- |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 2-(hexyliminomethyl)-4,6-dimethylphenol;iridium;2-phenylpyridine |
| SMILES | CCCCCC/N=C/c1cc(C)cc(C)c1O.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C15H23NO.C11H8N.Ir/c1-4-5-6-7-8-16-11-14-10-12(2)9-13(3)15(14)17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h9-11,17H,4-8H2,1-3H3;1-6,8-9H;/q;-1;/b16-11+;; |
| InChIKey | FVUZRWAKWAUHPU-RPVSWQTKSA-N |
| XLogP | 6.55 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|