C18H13IrN5-2 — CID 59800441
2-(1,2-diaza-3-azanidacyclopenta-1,4-dien-4-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 59800441) has the molecular formula C18H13IrN5-2 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-(1,2-diaza-3-azanidacyclopenta-1,4-dien-4-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(1,2-diaza-3-azanidacyclopenta-1,4-dien-4-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 59800441 |
| Molecular Formula | C18H13IrN5-2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-(1,2-diaza-3-azanidacyclopenta-1,4-dien-4-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccccc1-c1ccccn1.c1ccc(-c2cnn[n-]2)nc1 |
| InChI | InChI=1S/C11H8N.C7H5N4.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-2-4-8-6(3-1)7-5-9-11-10-7;/h1-6,8-9H;1-5H;/q2*-1; |
| InChIKey | LQOBXJRCVFYOTB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|