C16H18INO — CID 164740738
2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium iodide (PubChem CID 164740738) has the molecular formula C16H18INO and a molecular weight of 367.23 g/mol. Its IUPAC name is 2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium iodide.
| Compound Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium iodide |
|---|---|
| PubChem CID | 164740738 |
| Molecular Formula | C16H18INO |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium iodide |
| SMILES | COc1ccc(/C=C/c2cc(C)cc[n+]2C)cc1.[I-] |
| InChI | InChI=1S/C16H18NO.HI/c1-13-10-11-17(2)15(12-13)7-4-14-5-8-16(18-3)9-6-14;/h4-12H,1-3H3;1H/q+1;/p-1/b7-4+; |
| InChIKey | BFXPYHWBPXNDIP-KQGICBIGSA-M |
| XLogP | 0.00 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|