C16H16F2NO+ — CID 172720636
2-[(E)-2-(3,5-difluoro-4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium (PubChem CID 172720636) has the molecular formula C16H16F2NO+ and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[(E)-2-(3,5-difluoro-4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-[(E)-2-(3,5-difluoro-4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 172720636 |
| Molecular Formula | C16H16F2NO+ |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-[(E)-2-(3,5-difluoro-4-methoxyphenyl)ethenyl]-1,4-dimethylpyridin-1-ium |
| SMILES | COc1c(F)cc(/C=C/c2cc(C)cc[n+]2C)cc1F |
| InChI | InChI=1S/C16H16F2NO/c1-11-6-7-19(2)13(8-11)5-4-12-9-14(17)16(20-3)15(18)10-12/h4-10H,1-3H3/q+1/b5-4+ |
| InChIKey | GKBCRTNTJPPLCT-SNAWJCMRSA-N |
| XLogP | 3.28 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|