C23H16BrF7N2O6P+ — CID 164741289
(2-bromoethylamino)-oxo-[[2,3,5,6-tetrafluoro-4-[[4-nitro-3-[4-(trifluoromethyl)phenoxy]phenyl]methoxy]phenyl]methoxy]phosphanium (PubChem CID 164741289) has the molecular formula C23H16BrF7N2O6P+ and a molecular weight of 660.25 g/mol. Its IUPAC name is (2-bromoethylamino)-oxo-[[2,3,5,6-tetrafluoro-4-[[4-nitro-3-[4-(trifluoromethyl)phenoxy]phenyl]methoxy]phenyl]methoxy]phosphanium.
| Compound Name | (2-bromoethylamino)-oxo-[[2,3,5,6-tetrafluoro-4-[[4-nitro-3-[4-(trifluoromethyl)phenoxy]phenyl]methoxy]phenyl]methoxy]phosphanium |
|---|---|
| PubChem CID | 164741289 |
| Molecular Formula | C23H16BrF7N2O6P+ |
| Molecular Weight | 660.25 g/mol |
| Exact Mass | 658.98 |
| IUPAC Name | (2-bromoethylamino)-oxo-[[2,3,5,6-tetrafluoro-4-[[4-nitro-3-[4-(trifluoromethyl)phenoxy]phenyl]methoxy]phenyl]methoxy]phosphanium |
| SMILES | O=[N+]([O-])c1ccc(COc2c(F)c(F)c(CO[P+](=O)NCCBr)c(F)c2F)cc1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16BrF7N2O6P/c24-7-8-32-40(36)38-11-15-18(25)20(27)22(21(28)19(15)26)37-10-12-1-6-16(33(34)35)17(9-12)39-14-4-2-13(3-5-14)23(29,30)31/h1-6,9H,7-8,10-11H2,(H,32,36)/q+1 |
| InChIKey | LKIASMDMFIMPRS-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.25 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|