C17H16F3N4O5P — CID 166057372
5-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-2-(trifluoromethyl)pyridine (PubChem CID 166057372) has the molecular formula C17H16F3N4O5P and a molecular weight of 444.31 g/mol. Its IUPAC name is 5-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 166057372 |
| Molecular Formula | C17H16F3N4O5P |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 5-[5-[bis(aziridin-1-yl)phosphoryloxymethyl]-2-nitrophenoxy]-2-(trifluoromethyl)pyridine |
| SMILES | O=[N+]([O-])c1ccc(COP(=O)(N2CC2)N2CC2)cc1Oc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C17H16F3N4O5P/c18-17(19,20)16-4-2-13(10-21-16)29-15-9-12(1-3-14(15)24(25)26)11-28-30(27,22-5-6-22)23-7-8-23/h1-4,9-10H,5-8,11H2 |
| InChIKey | NLJLNVPYGUZPCZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|