C20H19F3N5O5P — CID 167001763
5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]-1-methylindazole (PubChem CID 167001763) has the molecular formula C20H19F3N5O5P and a molecular weight of 497.37 g/mol. Its IUPAC name is 5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]-1-methylindazole.
| Compound Name | 5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]-1-methylindazole |
|---|---|
| PubChem CID | 167001763 |
| Molecular Formula | C20H19F3N5O5P |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 5-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]-2,2,2-trifluoroethyl]-2-nitrophenoxy]-1-methylindazole |
| SMILES | Cn1ncc2cc(Oc3cc(C(OP(=O)(N4CC4)N4CC4)C(F)(F)F)ccc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H19F3N5O5P/c1-25-16-5-3-15(10-14(16)12-24-25)32-18-11-13(2-4-17(18)28(29)30)19(20(21,22)23)33-34(31,26-6-7-26)27-8-9-27/h2-5,10-12,19H,6-9H2,1H3 |
| InChIKey | TXTJBPVZMUHELD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 102.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|