C24H29N4O6P — CID 165016592
[4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-piperidin-1-ylmethanone (PubChem CID 165016592) has the molecular formula C24H29N4O6P and a molecular weight of 500.49 g/mol. Its IUPAC name is [4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 165016592 |
| Molecular Formula | C24H29N4O6P |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]phenyl]-piperidin-1-ylmethanone |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2ccc(C(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C24H29N4O6P/c1-18(34-35(32,26-13-14-26)27-15-16-27)20-7-10-22(28(30)31)23(17-20)33-21-8-5-19(6-9-21)24(29)25-11-3-2-4-12-25/h5-10,17-18H,2-4,11-16H2,1H3 |
| InChIKey | LJICKGRPLCPRGP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 105.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|