C15H17N4O5PS — CID 134259006
2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-thiazole (PubChem CID 134259006) has the molecular formula C15H17N4O5PS and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-thiazole.
| Compound Name | 2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-thiazole |
|---|---|
| PubChem CID | 134259006 |
| Molecular Formula | C15H17N4O5PS |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-thiazole |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2nccs2)c1 |
| InChI | InChI=1S/C15H17N4O5PS/c1-11(24-25(22,17-5-6-17)18-7-8-18)12-2-3-13(19(20)21)14(10-12)23-15-16-4-9-26-15/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | MHRRIRBMEQGPOK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|