C19H19N4O5PS — CID 134258954
2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzothiazole (PubChem CID 134258954) has the molecular formula C19H19N4O5PS and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzothiazole.
| Compound Name | 2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzothiazole |
|---|---|
| PubChem CID | 134258954 |
| Molecular Formula | C19H19N4O5PS |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-1,3-benzothiazole |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H19N4O5PS/c1-13(28-29(26,21-8-9-21)22-10-11-22)14-6-7-16(23(24)25)17(12-14)27-19-20-15-4-2-3-5-18(15)30-19/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | BKHUNNFHUCRJIC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|