C20H25N4O7PS — CID 134258958
4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 134258958) has the molecular formula C20H25N4O7PS and a molecular weight of 496.48 g/mol. Its IUPAC name is 4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134258958 |
| Molecular Formula | C20H25N4O7PS |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-2-nitrophenoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2ccc(S(=O)(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C20H25N4O7PS/c1-15(31-32(27,22-10-11-22)23-12-13-23)16-4-9-19(24(25)26)20(14-16)30-17-5-7-18(8-6-17)33(28,29)21(2)3/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | UAVXKANPCCVRCT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 122.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|