C18H18F2N3O5P — CID 134258999
1-[aziridin-1-yl-[1-[3-(2,6-difluorophenoxy)-4-nitrophenyl]ethoxy]phosphoryl]aziridine (PubChem CID 134258999) has the molecular formula C18H18F2N3O5P and a molecular weight of 425.33 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[1-[3-(2,6-difluorophenoxy)-4-nitrophenyl]ethoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[1-[3-(2,6-difluorophenoxy)-4-nitrophenyl]ethoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 134258999 |
| Molecular Formula | C18H18F2N3O5P |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-[aziridin-1-yl-[1-[3-(2,6-difluorophenoxy)-4-nitrophenyl]ethoxy]phosphoryl]aziridine |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(Oc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H18F2N3O5P/c1-12(28-29(26,21-7-8-21)22-9-10-22)13-5-6-16(23(24)25)17(11-13)27-18-14(19)3-2-4-15(18)20/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | MJRZGMGZRYXVQF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|