C14H20N3O6PS — CID 149314160
1-[aziridin-1-yl-[1-[3-(methylsulfonylmethyl)-4-nitrophenyl]ethoxy]phosphoryl]aziridine (PubChem CID 149314160) has the molecular formula C14H20N3O6PS and a molecular weight of 389.37 g/mol. Its IUPAC name is 1-[aziridin-1-yl-[1-[3-(methylsulfonylmethyl)-4-nitrophenyl]ethoxy]phosphoryl]aziridine.
| Compound Name | 1-[aziridin-1-yl-[1-[3-(methylsulfonylmethyl)-4-nitrophenyl]ethoxy]phosphoryl]aziridine |
|---|---|
| PubChem CID | 149314160 |
| Molecular Formula | C14H20N3O6PS |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 1-[aziridin-1-yl-[1-[3-(methylsulfonylmethyl)-4-nitrophenyl]ethoxy]phosphoryl]aziridine |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H20N3O6PS/c1-11(23-24(20,15-5-6-15)16-7-8-16)12-3-4-14(17(18)19)13(9-12)10-25(2,21)22/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | XZENLDPPIWNXJG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|