C19H30N5O5P — CID 135132997
5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-N-methyl-N-(2-morpholin-4-ylethyl)-2-nitroaniline (PubChem CID 135132997) has the molecular formula C19H30N5O5P and a molecular weight of 439.45 g/mol. Its IUPAC name is 5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-N-methyl-N-(2-morpholin-4-ylethyl)-2-nitroaniline.
| Compound Name | 5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-N-methyl-N-(2-morpholin-4-ylethyl)-2-nitroaniline |
|---|---|
| PubChem CID | 135132997 |
| Molecular Formula | C19H30N5O5P |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-N-methyl-N-(2-morpholin-4-ylethyl)-2-nitroaniline |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1ccc([N+](=O)[O-])c(N(C)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H30N5O5P/c1-16(29-30(27,22-7-8-22)23-9-10-23)17-3-4-18(24(25)26)19(15-17)20(2)5-6-21-11-13-28-14-12-21/h3-4,15-16H,5-14H2,1-2H3 |
| InChIKey | LVVVHAHOSYLNDM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|