C14H19FN3O4P — CID 176899858
1-[[(1S)-1-(3-fluoro-4-nitrophenyl)ethoxy]-(2-methylaziridin-1-yl)phosphoryl]-2-methylaziridine (PubChem CID 176899858) has the molecular formula C14H19FN3O4P and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-[[(1S)-1-(3-fluoro-4-nitrophenyl)ethoxy]-(2-methylaziridin-1-yl)phosphoryl]-2-methylaziridine.
| Compound Name | 1-[[(1S)-1-(3-fluoro-4-nitrophenyl)ethoxy]-(2-methylaziridin-1-yl)phosphoryl]-2-methylaziridine |
|---|---|
| PubChem CID | 176899858 |
| Molecular Formula | C14H19FN3O4P |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[[(1S)-1-(3-fluoro-4-nitrophenyl)ethoxy]-(2-methylaziridin-1-yl)phosphoryl]-2-methylaziridine |
| SMILES | CC1CN1P(=O)(O[C@@H](C)c1ccc([N+](=O)[O-])c(F)c1)N1CC1C |
| InChI | InChI=1S/C14H19FN3O4P/c1-9-7-16(9)23(21,17-8-10(17)2)22-11(3)12-4-5-14(18(19)20)13(15)6-12/h4-6,9-11H,7-8H2,1-3H3/t9?,10?,11-,16?,17?,23?/m0/s1 |
| InChIKey | YTBZVRDTMKGJNP-RHPHHFODSA-N |
| XLogP | 3.33 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|