C14H18Br2F4N3O4P — CID 176899853
(2S)-1-bromo-N-[[[(2S)-1-bromopropan-2-yl]amino]-[(1R)-2,2,2-trifluoro-1-(3-fluoro-4-nitrophenyl)ethoxy]phosphoryl]propan-2-amine (PubChem CID 176899853) has the molecular formula C14H18Br2F4N3O4P and a molecular weight of 559.09 g/mol. Its IUPAC name is (2S)-1-bromo-N-[[[(2S)-1-bromopropan-2-yl]amino]-[(1R)-2,2,2-trifluoro-1-(3-fluoro-4-nitrophenyl)ethoxy]phosphoryl]propan-2-amine.
| Compound Name | (2S)-1-bromo-N-[[[(2S)-1-bromopropan-2-yl]amino]-[(1R)-2,2,2-trifluoro-1-(3-fluoro-4-nitrophenyl)ethoxy]phosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 176899853 |
| Molecular Formula | C14H18Br2F4N3O4P |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 556.93 |
| IUPAC Name | (2S)-1-bromo-N-[[[(2S)-1-bromopropan-2-yl]amino]-[(1R)-2,2,2-trifluoro-1-(3-fluoro-4-nitrophenyl)ethoxy]phosphoryl]propan-2-amine |
| SMILES | C[C@@H](CBr)NP(=O)(N[C@@H](C)CBr)O[C@H](c1ccc([N+](=O)[O-])c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C14H18Br2F4N3O4P/c1-8(6-15)21-28(26,22-9(2)7-16)27-13(14(18,19)20)10-3-4-12(23(24)25)11(17)5-10/h3-5,8-9,13H,6-7H2,1-2H3,(H2,21,22,26)/t8-,9-,13+/m0/s1 |
| InChIKey | HJOXDVRKKGITCY-MWODSPESSA-N |
| XLogP | 5.21 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|