C24H25Br2FN3O5P — CID 165007170
2-bromo-N-[(2-bromoethylamino)-[1-[3-[4-(4-fluorophenyl)phenoxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine (PubChem CID 165007170) has the molecular formula C24H25Br2FN3O5P and a molecular weight of 645.26 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromoethylamino)-[1-[3-[4-(4-fluorophenyl)phenoxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine.
| Compound Name | 2-bromo-N-[(2-bromoethylamino)-[1-[3-[4-(4-fluorophenyl)phenoxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine |
|---|---|
| PubChem CID | 165007170 |
| Molecular Formula | C24H25Br2FN3O5P |
| Molecular Weight | 645.26 g/mol |
| Exact Mass | 642.99 |
| IUPAC Name | 2-bromo-N-[(2-bromoethylamino)-[1-[3-[4-(4-fluorophenyl)phenoxy]-4-nitrophenyl]ethoxy]phosphoryl]ethanamine |
| SMILES | CC(OP(=O)(NCCBr)NCCBr)c1ccc([N+](=O)[O-])c(Oc2ccc(-c3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C24H25Br2FN3O5P/c1-17(35-36(33,28-14-12-25)29-15-13-26)20-6-11-23(30(31)32)24(16-20)34-22-9-4-19(5-10-22)18-2-7-21(27)8-3-18/h2-11,16-17H,12-15H2,1H3,(H2,28,29,33) |
| InChIKey | OWRMRZVABFWCEW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.26 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|