C11H19BrN3O5P — CID 58463582
N-[(2-bromoethylamino)-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]propan-1-amine (PubChem CID 58463582) has the molecular formula C11H19BrN3O5P and a molecular weight of 384.17 g/mol. Its IUPAC name is N-[(2-bromoethylamino)-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]propan-1-amine.
| Compound Name | N-[(2-bromoethylamino)-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]propan-1-amine |
|---|---|
| PubChem CID | 58463582 |
| Molecular Formula | C11H19BrN3O5P |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[(2-bromoethylamino)-[1-(5-nitrofuran-2-yl)ethoxy]phosphoryl]propan-1-amine |
| SMILES | CCCNP(=O)(NCCBr)OC(C)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H19BrN3O5P/c1-3-7-13-21(18,14-8-6-12)20-9(2)10-4-5-11(19-10)15(16)17/h4-5,9H,3,6-8H2,1-2H3,(H2,13,14,18) |
| InChIKey | DFOUXNBYYCKHIY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|