C10H18Br2N5O4P — CID 143387249
2-bromo-N-[(2-bromoethylamino)-[(1S)-1-(3-methyl-2-nitroimidazol-4-yl)ethoxy]phosphoryl]ethanamine (PubChem CID 143387249) has the molecular formula C10H18Br2N5O4P and a molecular weight of 463.07 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromoethylamino)-[(1S)-1-(3-methyl-2-nitroimidazol-4-yl)ethoxy]phosphoryl]ethanamine.
| Compound Name | 2-bromo-N-[(2-bromoethylamino)-[(1S)-1-(3-methyl-2-nitroimidazol-4-yl)ethoxy]phosphoryl]ethanamine |
|---|---|
| PubChem CID | 143387249 |
| Molecular Formula | C10H18Br2N5O4P |
| Molecular Weight | 463.07 g/mol |
| Exact Mass | 460.95 |
| IUPAC Name | 2-bromo-N-[(2-bromoethylamino)-[(1S)-1-(3-methyl-2-nitroimidazol-4-yl)ethoxy]phosphoryl]ethanamine |
| SMILES | C[C@H](OP(=O)(NCCBr)NCCBr)c1cnc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C10H18Br2N5O4P/c1-8(9-7-13-10(16(9)2)17(18)19)21-22(20,14-5-3-11)15-6-4-12/h7-8H,3-6H2,1-2H3,(H2,14,15,20)/t8-/m0/s1 |
| InChIKey | NNWPNMRKABCFQW-QMMMGPOBSA-N |
| XLogP | 2.48 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.07 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|