C15H27BrN5O6P — CID 58463739
(3-methyl-2-nitroimidazol-4-yl)methyl 5-[(2-bromoethylamino)-(propylamino)phosphoryl]oxypentanoate (PubChem CID 58463739) has the molecular formula C15H27BrN5O6P and a molecular weight of 484.29 g/mol. Its IUPAC name is (3-methyl-2-nitroimidazol-4-yl)methyl 5-[(2-bromoethylamino)-(propylamino)phosphoryl]oxypentanoate.
| Compound Name | (3-methyl-2-nitroimidazol-4-yl)methyl 5-[(2-bromoethylamino)-(propylamino)phosphoryl]oxypentanoate |
|---|---|
| PubChem CID | 58463739 |
| Molecular Formula | C15H27BrN5O6P |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | (3-methyl-2-nitroimidazol-4-yl)methyl 5-[(2-bromoethylamino)-(propylamino)phosphoryl]oxypentanoate |
| SMILES | CCCNP(=O)(NCCBr)OCCCCC(=O)OCc1cnc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C15H27BrN5O6P/c1-3-8-18-28(25,19-9-7-16)27-10-5-4-6-14(22)26-12-13-11-17-15(20(13)2)21(23)24/h11H,3-10,12H2,1-2H3,(H2,18,19,25) |
| InChIKey | XYTHLAGBGUEBRA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|