C18H24Br2N5O7P — CID 89385630
methyl 5-[bis(2-bromoethylamino)phosphoryloxymethyl]-2-[(3-methyl-2-nitroimidazol-4-yl)methoxy]benzoate (PubChem CID 89385630) has the molecular formula C18H24Br2N5O7P and a molecular weight of 613.20 g/mol. Its IUPAC name is methyl 5-[bis(2-bromoethylamino)phosphoryloxymethyl]-2-[(3-methyl-2-nitroimidazol-4-yl)methoxy]benzoate.
| Compound Name | methyl 5-[bis(2-bromoethylamino)phosphoryloxymethyl]-2-[(3-methyl-2-nitroimidazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 89385630 |
| Molecular Formula | C18H24Br2N5O7P |
| Molecular Weight | 613.20 g/mol |
| Exact Mass | 610.98 |
| IUPAC Name | methyl 5-[bis(2-bromoethylamino)phosphoryloxymethyl]-2-[(3-methyl-2-nitroimidazol-4-yl)methoxy]benzoate |
| SMILES | COC(=O)c1cc(COP(=O)(NCCBr)NCCBr)ccc1OCc1cnc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C18H24Br2N5O7P/c1-24-14(10-21-18(24)25(27)28)12-31-16-4-3-13(9-15(16)17(26)30-2)11-32-33(29,22-7-5-19)23-8-6-20/h3-4,9-10H,5-8,11-12H2,1-2H3,(H2,22,23,29) |
| InChIKey | BRQRQNBSGIVENQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|