About cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine
cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine (PubChem CID 145219668) has the molecular formula C12H22N4O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine.
Molecular Properties
| Compound Name | cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine |
| PubChem CID | 145219668 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine |
| SMILES | C1CC1.CN1CC1.COCc1cnc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C6H9N3O3.C3H7N.C3H6/c1-8-5(4-12-2)3-7-6(8)9(10)11;1-4-2-3-4;1-2-3-1/h3H,4H2,1-2H3;2-3H2,1H3;1-3H2 |
| InChIKey | UOFNGTNEJVETBZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine?
The IUPAC name of cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine (CID 145219668) is cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine.
What is the SMILES notation for cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine?
The canonical SMILES for cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine is C1CC1.CN1CC1.COCc1cnc([N+](=O)[O-])n1C.
What is the InChIKey of cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine?
The InChIKey is UOFNGTNEJVETBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3.C3H7N.C3H6/c1-8-5(4-12-2)3-7-6(8)9(10)11;1-4-2-3-4;1-2-3-1/h3H,4H2,1-2H3;2-3H2,1H3;1-3H2.
What are the key properties of cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine?
cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine has a molecular weight of 270.33 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;5-(methoxymethyl)-1-methyl-2-nitroimidazole;1-methylaziridine is sourced from PubChem (CID 145219668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).