C7H7BrN6O2 — CID 165113642
3-bromo-1-[(3-methyl-2-nitroimidazol-4-yl)methyl]-1,2,4-triazole (PubChem CID 165113642) has the molecular formula C7H7BrN6O2 and a molecular weight of 287.08 g/mol. Its IUPAC name is 3-bromo-1-[(3-methyl-2-nitroimidazol-4-yl)methyl]-1,2,4-triazole.
| Compound Name | 3-bromo-1-[(3-methyl-2-nitroimidazol-4-yl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 165113642 |
| Molecular Formula | C7H7BrN6O2 |
| Molecular Weight | 287.08 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 3-bromo-1-[(3-methyl-2-nitroimidazol-4-yl)methyl]-1,2,4-triazole |
| SMILES | Cn1c(Cn2cnc(Br)n2)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7BrN6O2/c1-12-5(2-9-7(12)14(15)16)3-13-4-10-6(8)11-13/h2,4H,3H2,1H3 |
| InChIKey | BFEUAHXOZYELSY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.08 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|