C7H5BrN4O2S — CID 47058564
1-[(5-bromothiophen-3-yl)methyl]-3-nitro-1,2,4-triazole (PubChem CID 47058564) has the molecular formula C7H5BrN4O2S and a molecular weight of 289.11 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]-3-nitro-1,2,4-triazole.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 47058564 |
| Molecular Formula | C7H5BrN4O2S |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]-3-nitro-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ncn(Cc2csc(Br)c2)n1 |
| InChI | InChI=1S/C7H5BrN4O2S/c8-6-1-5(3-15-6)2-11-4-9-7(10-11)12(13)14/h1,3-4H,2H2 |
| InChIKey | UBOFNQUNPJSANB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|