About (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate
(3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate (PubChem CID 58463611) has the molecular formula C11H17N3O5
and a molecular weight of 271.27 g/mol. Its IUPAC name is (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate.
Molecular Properties
| Compound Name | (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate |
| PubChem CID | 58463611 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate |
| SMILES | Cn1c(COC(=O)CCCCCO)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O5/c1-13-9(7-12-11(13)14(17)18)8-19-10(16)5-3-2-4-6-15/h7,15H,2-6,8H2,1H3 |
| InChIKey | SSKYBZZOELHUFX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate?
The IUPAC name of (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate (CID 58463611) is (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate.
What is the SMILES notation for (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate?
The canonical SMILES for (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate is Cn1c(COC(=O)CCCCCO)cnc1[N+](=O)[O-].
What is the InChIKey of (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate?
The InChIKey is SSKYBZZOELHUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O5/c1-13-9(7-12-11(13)14(17)18)8-19-10(16)5-3-2-4-6-15/h7,15H,2-6,8H2,1H3.
What are the key properties of (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate?
(3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate has a molecular weight of 271.27 g/mol, XLogP of 0.92, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-nitroimidazol-4-yl)methyl 6-hydroxyhexanoate is sourced from PubChem (CID 58463611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).