C9H16Cl2N5O4P — CID 58463732
N-[amino-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine (PubChem CID 58463732) has the molecular formula C9H16Cl2N5O4P and a molecular weight of 360.14 g/mol. Its IUPAC name is N-[amino-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine.
| Compound Name | N-[amino-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|---|
| PubChem CID | 58463732 |
| Molecular Formula | C9H16Cl2N5O4P |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[amino-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
| SMILES | Cn1c(COP(N)(=O)N(CCCl)CCCl)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16Cl2N5O4P/c1-14-8(6-13-9(14)16(17)18)7-20-21(12,19)15(4-2-10)5-3-11/h6H,2-5,7H2,1H3,(H2,12,19) |
| InChIKey | YEYPQGJRLZZECK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|