C26H24N6O5 — CID 174150236
1-(4-methoxyphenyl)-6-[2-methyl-4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]anilino]-3H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 174150236) has the molecular formula C26H24N6O5 and a molecular weight of 500.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-6-[2-methyl-4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]anilino]-3H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 1-(4-methoxyphenyl)-6-[2-methyl-4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]anilino]-3H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 174150236 |
| Molecular Formula | C26H24N6O5 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-6-[2-methyl-4-[(3-methyl-2-nitroimidazol-4-yl)methoxy]anilino]-3H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | COc1ccc(N2C(=O)Cc3cnc(Nc4ccc(OCc5cnc([N+](=O)[O-])n5C)cc4C)cc32)cc1 |
| InChI | InChI=1S/C26H24N6O5/c1-16-10-21(37-15-19-14-28-26(30(19)2)32(34)35)8-9-22(16)29-24-12-23-17(13-27-24)11-25(33)31(23)18-4-6-20(36-3)7-5-18/h4-10,12-14H,11,15H2,1-3H3,(H,27,29) |
| InChIKey | GGEQYCMWUPRHQW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|