C10H16Br2N3O4PS — CID 163423323
2-bromo-N-[(2-bromoethylamino)-[(4-methyl-5-nitrothiophen-2-yl)methoxy]phosphoryl]ethanamine (PubChem CID 163423323) has the molecular formula C10H16Br2N3O4PS and a molecular weight of 465.10 g/mol. Its IUPAC name is 2-bromo-N-[(2-bromoethylamino)-[(4-methyl-5-nitrothiophen-2-yl)methoxy]phosphoryl]ethanamine.
| Compound Name | 2-bromo-N-[(2-bromoethylamino)-[(4-methyl-5-nitrothiophen-2-yl)methoxy]phosphoryl]ethanamine |
|---|---|
| PubChem CID | 163423323 |
| Molecular Formula | C10H16Br2N3O4PS |
| Molecular Weight | 465.10 g/mol |
| Exact Mass | 462.90 |
| IUPAC Name | 2-bromo-N-[(2-bromoethylamino)-[(4-methyl-5-nitrothiophen-2-yl)methoxy]phosphoryl]ethanamine |
| SMILES | Cc1cc(COP(=O)(NCCBr)NCCBr)sc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16Br2N3O4PS/c1-8-6-9(21-10(8)15(16)17)7-19-20(18,13-4-2-11)14-5-3-12/h6H,2-5,7H2,1H3,(H2,13,14,18) |
| InChIKey | AKIZKABVJPJIHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.10 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|