C8H6N4O8PS2- — CID 118541597
bis[(2-nitro-1,3-thiazol-5-yl)methyl] phosphate (PubChem CID 118541597) has the molecular formula C8H6N4O8PS2- and a molecular weight of 381.26 g/mol. Its IUPAC name is bis[(2-nitro-1,3-thiazol-5-yl)methyl] phosphate.
| Compound Name | bis[(2-nitro-1,3-thiazol-5-yl)methyl] phosphate |
|---|---|
| PubChem CID | 118541597 |
| Molecular Formula | C8H6N4O8PS2- |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | bis[(2-nitro-1,3-thiazol-5-yl)methyl] phosphate |
| SMILES | O=[N+]([O-])c1ncc(COP(=O)([O-])OCc2cnc([N+](=O)[O-])s2)s1 |
| InChI | InChI=1S/C8H7N4O8PS2/c13-11(14)7-9-1-5(22-7)3-19-21(17,18)20-4-6-2-10-8(23-6)12(15)16/h1-2H,3-4H2,(H,17,18)/p-1 |
| InChIKey | MOHNRZBJUMSWKT-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 170.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|