C9H13N3O4S — CID 10563215
2-ethoxy-4-(2-nitro-1,3-thiazol-5-yl)morpholine (PubChem CID 10563215) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-ethoxy-4-(2-nitro-1,3-thiazol-5-yl)morpholine.
| Compound Name | 2-ethoxy-4-(2-nitro-1,3-thiazol-5-yl)morpholine |
|---|---|
| PubChem CID | 10563215 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-ethoxy-4-(2-nitro-1,3-thiazol-5-yl)morpholine |
| SMILES | CCOC1CN(c2cnc([N+](=O)[O-])s2)CCO1 |
| InChI | InChI=1S/C9H13N3O4S/c1-2-15-8-6-11(3-4-16-8)7-5-10-9(17-7)12(13)14/h5,8H,2-4,6H2,1H3 |
| InChIKey | BHZBTYJDELHIBP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|