C16H26N5O7+ — CID 91144440
dimethoxy-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]-(5-nitropyrimidin-2-yl)azanium (PubChem CID 91144440) has the molecular formula C16H26N5O7+ and a molecular weight of 400.41 g/mol. Its IUPAC name is dimethoxy-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]-(5-nitropyrimidin-2-yl)azanium.
| Compound Name | dimethoxy-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]-(5-nitropyrimidin-2-yl)azanium |
|---|---|
| PubChem CID | 91144440 |
| Molecular Formula | C16H26N5O7+ |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | dimethoxy-[[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]methyl]-(5-nitropyrimidin-2-yl)azanium |
| SMILES | CO[N+](CC1CN(C(=O)OC(C)(C)C)CCO1)(OC)c1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H26N5O7/c1-16(2,3)28-15(22)19-6-7-27-13(10-19)11-21(25-4,26-5)14-17-8-12(9-18-14)20(23)24/h8-9,13H,6-7,10-11H2,1-5H3/q+1 |
| InChIKey | QZISODAKRWPIPX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 126.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|