C19H23N5O3S — CID 66597428
2-ethoxy-4-[2-(4-methoxyphenyl)sulfanyl-9-methylpurin-6-yl]morpholine (PubChem CID 66597428) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-ethoxy-4-[2-(4-methoxyphenyl)sulfanyl-9-methylpurin-6-yl]morpholine.
| Compound Name | 2-ethoxy-4-[2-(4-methoxyphenyl)sulfanyl-9-methylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 66597428 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-ethoxy-4-[2-(4-methoxyphenyl)sulfanyl-9-methylpurin-6-yl]morpholine |
| SMILES | CCOC1CN(c2nc(Sc3ccc(OC)cc3)nc3c2ncn3C)CCO1 |
| InChI | InChI=1S/C19H23N5O3S/c1-4-26-15-11-24(9-10-27-15)18-16-17(23(2)12-20-16)21-19(22-18)28-14-7-5-13(25-3)6-8-14/h5-8,12,15H,4,9-11H2,1-3H3 |
| InChIKey | SIICYWXOAXAUJH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |