About 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline
5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline (PubChem CID 66597171) has the molecular formula C18H20N6OS
and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline.
Molecular Properties
| Compound Name | 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline |
| PubChem CID | 66597171 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline |
| SMILES | COc1ccc(CSc2nc(N3CC=CC3)c3ncn(C)c3n2)cc1N |
| InChI | InChI=1S/C18H20N6OS/c1-23-11-20-15-16(23)21-18(22-17(15)24-7-3-4-8-24)26-10-12-5-6-14(25-2)13(19)9-12/h3-6,9,11H,7-8,10,19H2,1-2H3 |
| InChIKey | GSJKJHPQHRJDOR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline?
The IUPAC name of 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline (CID 66597171) is 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline.
What is the SMILES notation for 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline?
The canonical SMILES for 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline is COc1ccc(CSc2nc(N3CC=CC3)c3ncn(C)c3n2)cc1N.
What is the InChIKey of 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline?
The InChIKey is GSJKJHPQHRJDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6OS/c1-23-11-20-15-16(23)21-18(22-17(15)24-7-3-4-8-24)26-10-12-5-6-14(25-2)13(19)9-12/h3-6,9,11H,7-8,10,19H2,1-2H3.
What are the key properties of 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline?
5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline has a molecular weight of 368.47 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-(2,5-dihydropyrrol-1-yl)-9-methylpurin-2-yl]sulfanylmethyl]-2-methoxyaniline is sourced from PubChem (CID 66597171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).