C22H39N5OSn — CID 141284313
tributyl-(9-methyl-6-morpholin-4-ylpurin-2-yl)stannane (PubChem CID 141284313) has the molecular formula C22H39N5OSn and a molecular weight of 508.30 g/mol. Its IUPAC name is tributyl-(9-methyl-6-morpholin-4-ylpurin-2-yl)stannane.
| Compound Name | tributyl-(9-methyl-6-morpholin-4-ylpurin-2-yl)stannane |
|---|---|
| PubChem CID | 141284313 |
| Molecular Formula | C22H39N5OSn |
| Molecular Weight | 508.30 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | tributyl-(9-methyl-6-morpholin-4-ylpurin-2-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1nc(N2CCOCC2)c2ncn(C)c2n1 |
| InChI | InChI=1S/C10H12N5O.3C4H9.Sn/c1-14-7-13-8-9(14)11-6-12-10(8)15-2-4-16-5-3-15;3*1-3-4-2;/h7H,2-5H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YPFCTPLVGJBAHI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |