C13H21N7 — CID 15016760
N,N,9-trimethyl-6-(4-methylpiperazin-1-yl)purin-2-amine (PubChem CID 15016760) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is N,N,9-trimethyl-6-(4-methylpiperazin-1-yl)purin-2-amine.
| Compound Name | N,N,9-trimethyl-6-(4-methylpiperazin-1-yl)purin-2-amine |
|---|---|
| PubChem CID | 15016760 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N,N,9-trimethyl-6-(4-methylpiperazin-1-yl)purin-2-amine |
| SMILES | CN1CCN(c2nc(N(C)C)nc3c2ncn3C)CC1 |
| InChI | InChI=1S/C13H21N7/c1-17(2)13-15-11-10(14-9-19(11)4)12(16-13)20-7-5-18(3)6-8-20/h9H,5-8H2,1-4H3 |
| InChIKey | ZBQWYMUAJRTSRY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |